EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O4 |
| Net Charge | 0 |
| Average Mass | 326.352 |
| Monoisotopic Mass | 326.12666 |
| SMILES | O=C(O)c1cccc2c1ccc1c(CCN3CCOCC3)noc12 |
| InChI | InChI=1S/C18H18N2O4/c21-18(22)14-3-1-2-13-12(14)4-5-15-16(19-24-17(13)15)6-7-20-8-10-23-11-9-20/h1-5H,6-11H2,(H,21,22) |
| InChIKey | ABLWXHACHIZQMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | PubMed (30688448) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fusaravenin (CHEBI:207136) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 3-(2-morpholin-4-ylethyl)benzo[g][1,2]benzoxazole-6-carboxylic acid |