EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | CC(C)=CC[C@@]12C=C(C(=O)O)C[C@@H]1OC2=O |
| InChI | InChI=1S/C12H14O4/c1-7(2)3-4-12-6-8(10(13)14)5-9(12)16-11(12)15/h3,6,9H,4-5H2,1-2H3,(H,13,14)/t9-,12+/m0/s1 |
| InChIKey | XYNBKIVTFGGLMN-JOYOIKCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boreostereum vibrans (ncbitaxon:1826779) | - | PubMed (23909294) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vibralactone H (CHEBI:207086) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1R,5S)-1-(3-methylbut-2-enyl)-7-oxo-6-oxabicyclo[3.2.0]hept-2-ene-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441075 | ChemSpider |