EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H47N9O11 |
| Net Charge | 0 |
| Average Mass | 685.736 |
| Monoisotopic Mass | 685.33950 |
| SMILES | CC/C(C)=C(/NC(=O)[C@H](C)NC(=O)[C@@H]1CCC=NN1C(=O)[C@@H](NC(=O)[C@H](C)NC(=O)C(N)(CO)CO)[C@H](C)N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C28H47N9O11/c1-6-13(2)19(24(44)34-17(10-38)26(46)47)35-21(41)15(4)32-23(43)18-8-7-9-31-37(18)25(45)20(14(3)29)36-22(42)16(5)33-27(48)28(30,11-39)12-40/h9,14-18,20,38-40H,6-8,10-12,29-30H2,1-5H3,(H,32,43)(H,33,48)(H,34,44)(H,35,41)(H,36,42)(H,46,47)/b19-13+/t14-,15-,16-,17-,18-,20-/m0/s1 |
| InChIKey | JIGYSKMCUNIKPN-KYVSZOTASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1080/00021369.1982.10865166) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cirratiomycin B (CHEBI:207056) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(E)-2-[[(2S)-2-[[(3S)-2-[(2S,3S)-3-amino-2-[[(2S)-2-[[2-amino-3-hydroxy-2-(hydroxymethyl)propanoyl]amino]propanoyl]amino]butanoyl]-4,5-dihydro-3H-pyridazine-3-carbonyl]amino]propanoyl]amino]-3-methylpent-2-enoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4587175 | ChemSpider |