EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40N2O8 |
| Net Charge | 0 |
| Average Mass | 520.623 |
| Monoisotopic Mass | 520.27847 |
| SMILES | CCCCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(N)c2O)C(=O)O[C@@H](C)[C@@H]1OC(=O)[C@@H](C)CC |
| InChI | InChI=1S/C27H40N2O8/c1-6-8-9-10-12-19-23(37-25(32)15(3)7-2)17(5)36-27(34)21(16(4)35-26(19)33)29-24(31)18-13-11-14-20(28)22(18)30/h11,13-17,19,21,23,30H,6-10,12,28H2,1-5H3,(H,29,31)/t15-,16+,17-,19+,21-,23-/m0/s1 |
| InChIKey | UAHVBUFGWRYNSY-ZMAMPDHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies THS-55 (ncbitaxon:1551467) | - | PubMed (28176847) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deformylated antimycin A1a (CHEBI:207023) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2R,3S,6S,7R,8R)-3-[(3-amino-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] (2S)-2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 61708772 | ChemSpider |