EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39NO3 |
| Net Charge | 0 |
| Average Mass | 401.591 |
| Monoisotopic Mass | 401.29299 |
| SMILES | CCCCCCCCC(C)/C=C(C)/C=C/C(=O)NC(CO)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H39NO3/c1-4-5-6-7-8-9-10-20(2)17-21(3)11-16-25(29)26-23(19-27)18-22-12-14-24(28)15-13-22/h11-17,20,23,27-28H,4-10,18-19H2,1-3H3,(H,26,29)/b16-11+,21-17+ |
| InChIKey | WFNJGQLTDMBMCF-KCLOMAENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Westerdykella dispersa (ncbitaxon:45154) | - | PubMed (28931947) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gymnastatin Z (CHEBI:206969) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (2E,4E)-N-[1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-4,6-dimethyltetradeca-2,4-dienamide |
| Manual Xrefs | Databases |
|---|---|
| 63002596 | ChemSpider |