EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41NO5 |
| Net Charge | 0 |
| Average Mass | 447.616 |
| Monoisotopic Mass | 447.29847 |
| SMILES | CO[C@H]1CC(=O)[C@@]23C(=O)N[C@@H](CC(C)C)[C@@H]2[C@H](C)C(C)=C[C@@H]3/C=C(\C)C[C@H](CO)C[C@@H]1O |
| InChI | InChI=1S/C26H41NO5/c1-14(2)7-20-24-17(5)16(4)10-19-9-15(3)8-18(13-28)11-21(29)22(32-6)12-23(30)26(19,24)25(31)27-20/h9-10,14,17-22,24,28-29H,7-8,11-13H2,1-6H3,(H,27,31)/b15-9+/t17-,18+,19+,20+,21+,22+,24+,26-/m1/s1 |
| InChIKey | IVHIYFAYONFDBJ-OGLYOTCJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Westerdykella dispersa (ncbitaxon:45154) | - | PubMed (28931947) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-methoxy-19,20-dihydrophomacin C (CHEBI:206956) has role fungal metabolite (CHEBI:76946) |
| 19-methoxy-19,20-dihydrophomacin C (CHEBI:206956) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1S,4S,5S,7S,9E,11S,14S,15R,16S)-5-hydroxy-7-(hydroxymethyl)-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 63002593 | ChemSpider |