EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39NO4 |
| Net Charge | 0 |
| Average Mass | 417.590 |
| Monoisotopic Mass | 417.28791 |
| SMILES | CC1=C[C@@H]2/C=C(\C)C[C@H](CO)C[C@H](O)CCC(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C25H39NO4/c1-14(2)8-21-23-17(5)16(4)11-19-10-15(3)9-18(13-27)12-20(28)6-7-22(29)25(19,23)24(30)26-21/h10-11,14,17-21,23,27-28H,6-9,12-13H2,1-5H3,(H,26,30)/b15-10+/t17-,18+,19+,20-,21+,23+,25-/m1/s1 |
| InChIKey | MALMZNYRVHFIPB-UIUXMUEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Westerdykella dispersa (ncbitaxon:45154) | - | PubMed (28931947) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19,20-dihydrophomacin C (CHEBI:206951) has role fungal metabolite (CHEBI:76946) |
| 19,20-dihydrophomacin C (CHEBI:206951) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1S,5R,7S,9E,11S,14S,15R,16S)-5-hydroxy-7-(hydroxymethyl)-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 63002592 | ChemSpider |