EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H52O13 |
| Net Charge | 0 |
| Average Mass | 608.722 |
| Monoisotopic Mass | 608.34079 |
| SMILES | CC[C@H](C)[C@@H](O)C(=O)O[C@@H](C(=O)O[C@@H](C(=O)O[C@@H](C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)CO)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)CC |
| InChI | InChI=1S/C29H52O13/c1-9-15(5)21(33)26(35)40-24(17(7)11-3)28(37)42-25(18(8)12-4)29(38)41-23(16(6)10-2)27(36)39-14-20(32)22(34)19(31)13-30/h15-25,30-34H,9-14H2,1-8H3/t15-,16-,17-,18-,19+,20+,21+,22-,23+,24+,25+/m0/s1 |
| InChIKey | MDKMYANJMGYULB-RWIOIQJPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dothioraspecies (ncbitaxon:2420193) | - | PubMed (28277681) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hormonemate F (CHEBI:206950) is a depsipeptide (CHEBI:23643) |
| IUPAC Name |
|---|
| [(2R,3S)-3-methyl-1-[(2R,3S)-3-methyl-1-[(2R,3S)-3-methyl-1-oxo-1-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentoxy]pentan-2-yl]oxy-1-oxopentan-2-yl]oxy-1-oxopentan-2-yl] (2R,3S)-2-hydroxy-3-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 76787492 | ChemSpider |