EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H54N2O11 |
| Net Charge | 0 |
| Average Mass | 774.908 |
| Monoisotopic Mass | 774.37276 |
| SMILES | C/C=C/C(O)C(C)(C)C1C/C=C\C=C/C=CC(OC)Cc2nc(co2)C(=O)OC(C(C)(C)C(O)/C=C/C)CC2OC2C2OC2/C=C/C=C\c2nc(co2)C(=O)O1 |
| InChI | InChI=1S/C43H54N2O11/c1-8-17-32(46)42(3,4)34-21-14-12-10-11-13-19-27(50-7)23-37-45-29(26-52-37)41(49)56-35(43(5,6)33(47)18-9-2)24-31-39(54-31)38-30(53-38)20-15-16-22-36-44-28(25-51-36)40(48)55-34/h8-20,22,25-27,30-35,38-39,46-47H,21,23-24H2,1-7H3/b11-10-,14-12-,17-8+,18-9+,19-13?,20-15+,22-16- |
| InChIKey | QBKIVBASHDDBID-CLXWHGGYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium (ncbitaxon:39643) | - | DOI (10.1002/jlac.199419940802) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disorazole H (CHEBI:206946) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (12E,14Z,24Z,26Z)-4,22-bis[(E)-3-hydroxy-2-methylhex-4-en-2-yl]-30-methoxy-3,7,10,17,21,33-hexaoxa-35,36-diazapentacyclo[30.2.1.116,19.06,8.09,11]hexatriaconta-1(34),12,14,16(36),18,24,26,28,32(35)-nonaene-2,20-dione |