EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O6 |
| Net Charge | 0 |
| Average Mass | 268.265 |
| Monoisotopic Mass | 268.09469 |
| SMILES | C[C@@H]1O[C@](C)(C(=O)O)O[C@H]1/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C13H16O6/c1-9-10(19-13(2,18-9)12(16)17)7-5-3-4-6-8-11(14)15/h3-10H,1-2H3,(H,14,15)(H,16,17)/b4-3+,7-5+,8-6+/t9-,10-,13-/m0/s1 |
| InChIKey | RPBJCRSEGUSGHK-SGKIGDJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces fradiae (ncbitaxon:1906) | - | PubMed (23203266) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fradic acid A (CHEBI:206916) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2S,4S,5S)-4-[(1E,3E,5E)-6-carboxyhexa-1,3,5-trienyl]-2,5-dimethyl-1,3-dioxolane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 29215267 | ChemSpider |