EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37N5O8 |
| Net Charge | 0 |
| Average Mass | 487.554 |
| Monoisotopic Mass | 487.26421 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H37N5O8/c1-10(2)7-13(24-18(30)12(22)5-6-16(23)27)19(31)25-14(9-17(28)29)20(32)26-15(21(33)34)8-11(3)4/h10-15H,5-9,22H2,1-4H3,(H2,23,27)(H,24,30)(H,25,31)(H,26,32)(H,28,29)(H,33,34)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | IAALRVSZQPJMNE-AJNGGQMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (31246442) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Leu-Asp-Leu (CHEBI:206854) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-3-carboxy-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |