EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35N5O8 |
| Net Charge | 0 |
| Average Mass | 473.527 |
| Monoisotopic Mass | 473.24856 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(N)=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H35N5O8/c1-9(2)7-13(20(32)33)24-19(31)16(10(3)4)25-18(30)12(8-15(27)28)23-17(29)11(21)5-6-14(22)26/h9-13,16H,5-8,21H2,1-4H3,(H2,22,26)(H,23,29)(H,24,31)(H,25,30)(H,27,28)(H,32,33)/t11-,12-,13-,16-/m0/s1 |
| InChIKey | YVDHKEZQOSFSPC-QCQGSNGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | - | PubMed (31246442) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Asp-Val-Leu (CHEBI:206850) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-3-carboxy-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |