EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H56N6O12 |
| Net Charge | 0 |
| Average Mass | 752.863 |
| Monoisotopic Mass | 752.39562 |
| SMILES | CC(=O)N[C@@H](CCCN(O)C(=O)/C=C(\C)CCO)C(=O)OCC/C(C)=C/C(=O)NCCC[C@@H]1NC(=O)[C@H](CCCN(O)C(=O)/C=C(\C)CCO)NC1=O |
| InChI | InChI=1S/C35H56N6O12/c1-23(11-17-42)21-31(46)40(51)15-6-9-28-34(49)38-27(33(48)39-28)8-5-14-36-30(45)20-25(3)13-19-53-35(50)29(37-26(4)44)10-7-16-41(52)32(47)22-24(2)12-18-43/h20-22,27-29,42-43,51-52H,5-19H2,1-4H3,(H,36,45)(H,37,44)(H,38,49)(H,39,48)/b23-21+,24-22+,25-20+/t27-,28-,29-/m0/s1 |
| InChIKey | CPURAJDFSOZHME-GLTVSLITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromycesspecies CMB-W045 (ncbitaxon:1811500) | - | PubMed (28058837) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talarazine D (CHEBI:206845) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(E)-5-[3-[(2S,5S)-5-[3-[hydroxy-[(E)-5-hydroxy-3-methylpent-2-enoyl]amino]propyl]-3,6-dioxopiperazin-2-yl]propylamino]-3-methyl-5-oxopent-3-enyl] (2S)-2-acetamido-5-[hydroxy-[(E)-5-hydroxy-3-methylpent-2-enoyl]amino]pentanoate |
| Manual Xrefs | Databases |
|---|---|
| 76794920 | ChemSpider |