EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | CC(C)c1cc(O)cc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C14H14O3/c1-8(2)12-7-11(15)5-9-3-4-10(14(16)17)6-13(9)12/h3-8,15H,1-2H3,(H,16,17) |
| InChIKey | WAHQRVDWBUGXLB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptosphaerulina (ncbitaxon:55172) | - | DOI (10.1016/j.phytol.2017.05.010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leptosnaphthoic acid A (CHEBI:206834) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 6-hydroxy-8-propan-2-ylnaphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 63002579 | ChemSpider |