EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O7 |
| Net Charge | 0 |
| Average Mass | 428.566 |
| Monoisotopic Mass | 428.27740 |
| SMILES | CCOC(=O)[C@H](C)[C@H]1CC[C@@H](C[C@H](CC)OC(=O)[C@@H](C)[C@@H]2CC[C@H](C[C@@H](C)O)O2)O1 |
| InChI | InChI=1S/C23H40O7/c1-6-17(13-19-9-11-20(29-19)15(4)22(25)27-7-2)30-23(26)16(5)21-10-8-18(28-21)12-14(3)24/h14-21,24H,6-13H2,1-5H3/t14-,15-,16+,17+,18-,19+,20-,21+/m1/s1 |
| InChIKey | ZVKREMVFSQFIJJ-OJCIERFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus pumilus (ncbitaxon:1408) | - | PubMed (25044594) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-ethyl homononactyl nonactate (CHEBI:206825) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(2S)-1-[(2S,5R)-5-[(2R)-1-ethoxy-1-oxopropan-2-yl]oxolan-2-yl]butan-2-yl] (2S)-2-[(2S,5R)-5-[(2R)-2-hydroxypropyl]oxolan-2-yl]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 78438412 | ChemSpider |