EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H59N3O9 |
| Net Charge | 0 |
| Average Mass | 797.990 |
| Monoisotopic Mass | 797.42513 |
| SMILES | CCC(C)[C@H]1OC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C46H59N3O9/c1-10-31(6)40-43(52)49(9)36(27-33-22-16-12-17-23-33)45(54)57-38(29(2)3)41(50)47(7)35(26-32-20-14-11-15-21-32)44(53)56-39(30(4)5)42(51)48(8)37(46(55)58-40)28-34-24-18-13-19-25-34/h11-25,29-31,35-40H,10,26-28H2,1-9H3/t31?,35-,36-,37-,38-,39-,40-/m1/s1 |
| InChIKey | JQUGYVKOYKGIRB-FDSMQOSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria bassiana (ncbitaxon:176275) | - | DOI (10.1021/np50119a012) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauvericin A (CHEBI:206815) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6R,9R,12R,15R,18R)-3,9,15-tribenzyl-6-butan-2-yl-4,10,16-trimethyl-12,18-di(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |