EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O7 |
| Net Charge | 0 |
| Average Mass | 384.384 |
| Monoisotopic Mass | 384.12090 |
| SMILES | COC1=CC(=O)c2c(O)cc(OC)c3c2C1=C[C@]1(C)[C@H](O)C(=O)C=C(OC)[C@H]31 |
| InChI | InChI=1S/C21H20O7/c1-21-8-9-13(26-2)5-10(22)17-11(23)6-14(27-3)18(16(9)17)19(21)15(28-4)7-12(24)20(21)25/h5-8,19-20,23,25H,1-4H3/t19-,20-,21+/m1/s1 |
| InChIKey | BEEAOSMHUSDOTP-NJYVYQBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Preussia minimoides (ncbitaxon:269686) | - | PubMed (27673367) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Minimoidione A (CHEBI:206813) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (7aS,8S,11aS)-3,8-dihydroxy-1,6,11-trimethoxy-7a-methyl-8,11a-dihydrobenzo[a]phenalene-4,9-dione |
| Manual Xrefs | Databases |
|---|---|
| 76803148 | ChemSpider |