EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | C=C1CC[C@H]2[C@@](C)(CO)CCC[C@]2(C)[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-11-5-6-13-15(2,10-17)7-4-8-16(13,3)12(11)9-14(18)19/h12-13,17H,1,4-10H2,2-3H3,(H,18,19)/t12-,13-,15+,16+/m0/s1 |
| InChIKey | MWKMUMSWEZPDMP-WMHQRMGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryosphaeria (ncbitaxon:45132) | - | DOI (10.1002/hlca.200800424) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botryosphaerin D (CHEBI:206798) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-[(1S,4aR,5S,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441270 | ChemSpider |