EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29ClO7 |
| Net Charge | 0 |
| Average Mass | 428.909 |
| Monoisotopic Mass | 428.16018 |
| SMILES | CCC(C)[C@@H](O)[C@@](C)(O)/C=C/c1cc2c(o1)[C@@H](CO)[C@H](OC(C)=O)[C@@](C)(Cl)C2=O |
| InChI | InChI=1S/C21H29ClO7/c1-6-11(2)17(25)20(4,27)8-7-13-9-14-16(29-13)15(10-23)19(28-12(3)24)21(5,22)18(14)26/h7-9,11,15,17,19,23,25,27H,6,10H2,1-5H3/b8-7+/t11?,15-,17-,19+,20+,21+/m1/s1 |
| InChIKey | RNAWWYSOSNMVQZ-VZAOXIDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1016/j.phytol.2017.04.010) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arvoredol (CHEBI:206784) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| [(5R,6S,7S)-5-chloro-2-[(E,3S,4R)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-(hydroxymethyl)-5-methyl-4-oxo-6,7-dihydro-1-benzouran-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 62233288 | ChemSpider |