EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O4 |
| Net Charge | 0 |
| Average Mass | 172.140 |
| Monoisotopic Mass | 172.04841 |
| SMILES | N#CC(CC(=O)O)C(N)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c7-2-3(1-4(9)10)5(8)6(11)12/h3,5H,1,8H2,(H,9,10)(H,11,12) |
| InChIKey | ILQROMFBFXKCAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8501013) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beta-Cyanoglutamic acid (CHEBI:206759) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-cyanopentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 405340 | ChemSpider |