EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31NO7 |
| Net Charge | 0 |
| Average Mass | 385.457 |
| Monoisotopic Mass | 385.21005 |
| SMILES | CO[C@@H]1[C@@H](OC(=O)CNC(C)=O)[C@H](/C(C)=C/C=C/[C@H](O)[C@H](C)O)OC[C@@H]1C |
| InChI | InChI=1S/C19H31NO7/c1-11(7-6-8-15(23)13(3)21)18-19(17(25-5)12(2)10-26-18)27-16(24)9-20-14(4)22/h6-8,12-13,15,17-19,21,23H,9-10H2,1-5H3,(H,20,22)/b8-6+,11-7+/t12-,13-,15-,17-,18-,19+/m0/s1 |
| InChIKey | RJLXEVMSZRQSPQ-KZYAFLDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Westerdykella dispersa (ncbitaxon:45154) | - | PubMed (28842357) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (12S,13S)-N-acetyl-dihydroxylanomycin (CHEBI:206757) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(2S,3R,4S,5S)-2-[(2E,4E,6S,7S)-6,7-dihydroxyocta-2,4-dien-2-yl]-4-methoxy-5-methyloxan-3-yl] 2-acetamidoacetate |
| Manual Xrefs | Databases |
|---|---|
| 62429254 | ChemSpider |