EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43N3O8 |
| Net Charge | 0 |
| Average Mass | 561.676 |
| Monoisotopic Mass | 561.30502 |
| SMILES | CC(C)C[C@@H]1OC(=O)[C@H](C(C)C)NC(=O)[C@@H](CC(C)C)OC(=O)CCNC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C29H43N3O8/c1-16(2)13-22-28(37)32-25(18(5)6)29(38)40-23(14-17(3)4)27(36)31-21(15-19-7-9-20(33)10-8-19)26(35)30-12-11-24(34)39-22/h7-10,16-18,21-23,25,33H,11-15H2,1-6H3,(H,30,35)(H,31,36)(H,32,37)/t21-,22+,23-,25-/m0/s1 |
| InChIKey | SGWWIXUVSLBONP-AANQFLQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hapsidospora irregularis (ncbitaxon:95324) | - | PubMed (28106998) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leualacin G (CHEBI:206743) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2R,5S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-2,8-bis(2-methylpropyl)-5-propan-2-yl-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| Manual Xrefs | Databases |
|---|---|
| 78438916 | ChemSpider |