EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H45N3O7 |
| Net Charge | 0 |
| Average Mass | 559.704 |
| Monoisotopic Mass | 559.32575 |
| SMILES | CC(C)C[C@@H]1OC(=O)[C@H](C(C)C)NC(=O)[C@@H](CC(C)C)OC(=O)CCNC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C30H45N3O7/c1-18(2)15-23-28(36)32-26(20(5)6)30(38)40-24(16-19(3)4)29(37)33(7)22(17-21-11-9-8-10-12-21)27(35)31-14-13-25(34)39-23/h8-12,18-20,22-24,26H,13-17H2,1-7H3,(H,31,35)(H,32,36)/t22-,23+,24-,26-/m0/s1 |
| InChIKey | WZUMIQLQFAWCKV-UHCVVMIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hapsidospora irregularis (ncbitaxon:95324) | - | PubMed (28106998) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leualacin D (CHEBI:206725) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (2R,5S,8S,11S)-11-benzyl-10-methyl-2,8-bis(2-methylpropyl)-5-propan-2-yl-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| Manual Xrefs | Databases |
|---|---|
| 78438914 | ChemSpider |