EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21ClO7 |
| Net Charge | 0 |
| Average Mass | 384.812 |
| Monoisotopic Mass | 384.09758 |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]2CC(O)CCC(=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H21ClO7/c1-8-4-14-15(26-14)6-10(21)3-2-9(20)5-11-16(18(24)25-8)12(22)7-13(23)17(11)19/h7-8,10,14-15,21-23H,2-6H2,1H3/t8-,10?,14+,15-/m1/s1 |
| InChIKey | FWJXUORZSYISJM-PCDCQAMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia (ncbitaxon:243023) | - | DOI (10.1016/j.tet.2009.02.027) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pochonin O (CHEBI:206705) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (4R,6S,8R)-16-chloro-10,17,19-trihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),16,18-triene-2,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 78438410 | ChemSpider |