EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2O2S |
| Net Charge | 0 |
| Average Mass | 234.280 |
| Monoisotopic Mass | 234.04630 |
| SMILES | COc1csc(-c2ccccc2N)nc1=O |
| InChI | InChI=1S/C11H10N2O2S/c1-15-9-6-16-11(13-10(9)14)7-4-2-3-5-8(7)12/h2-6H,12H2,1H3 |
| InChIKey | NXOGKVZRJVBGOR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomycetospora (ncbitaxon:402649) | - | PubMed (25584783) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiasporine A (CHEBI:206676) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-(2-aminophenyl)-5-methoxy-1,3-thiazin-4-one |
| Manual Xrefs | Databases |
|---|---|
| 78435470 | ChemSpider |