EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O |
| Net Charge | 0 |
| Average Mass | 311.344 |
| Monoisotopic Mass | 311.10586 |
| SMILES | O=C(c1cnc2ccccc12)c1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C20H13N3O/c24-20(15-11-22-16-7-3-1-6-13(15)16)19-18-14(9-10-21-19)12-5-2-4-8-17(12)23-18/h1-11,22-23H |
| InChIKey | BQTUGQOWZZUYIA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malassezia furfur (ncbitaxon:55194) | - | PubMed (12029500) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pityriacitrin (CHEBI:206617) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1H-indol-3-yl(9H-pyrido[3,4-b]indol-1-yl)methanone |
| Manual Xrefs | Databases |
|---|---|
| 28486003 | ChemSpider |