EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | C[C@@H]1CC[C@@H]2C(=O)OC(=O)C2=C2CC(C)(C)C[C@@H]21 |
| InChI | InChI=1S/C15H20O3/c1-8-4-5-9-12(14(17)18-13(9)16)11-7-15(2,3)6-10(8)11/h8-10H,4-7H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | XISBONUQWBGHLA-KXUCPTDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coriolopsis (ncbitaxon:76125) | - | DOI (10.1016/j.cclet.2016.07.019) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coriolopsin A (CHEBI:206597) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (3aS,6R,6aR)-6,8,8-trimethyl-4,5,6,6a,7,9-hexahydro-3aH-azuleno[4,5-c]uran-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| 61708721 | ChemSpider |