EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO5 |
| Net Charge | 0 |
| Average Mass | 279.292 |
| Monoisotopic Mass | 279.11067 |
| SMILES | COC(=O)CCCCN1Cc2c(O)cc(O)cc2C1=O |
| InChI | InChI=1S/C14H17NO5/c1-20-13(18)4-2-3-5-15-8-11-10(14(15)19)6-9(16)7-12(11)17/h6-7,16-17H,2-5,8H2,1H3 |
| InChIKey | IVVBSFVDBKZHEA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diaporthe (ncbitaxon:36922) | - | PubMed (28119026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meyeroguilline C (CHEBI:206550) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 5-(5,7-dihydroxy-3-oxo-1H-isoindol-2-yl)pentanoate |
| Manual Xrefs | Databases |
|---|---|
| 61708500 | ChemSpider |