EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3C(C)(C)CCC[C@]3(C)C2(O)CC1 |
| InChI | InChI=1S/C20H28O3/c1-6-18(4)10-11-20(23)13(12-18)14(21)15(22)16-17(2,3)8-7-9-19(16,20)5/h6,12,22-23H,1,7-11H2,2-5H3/t18-,19-,20?/m0/s1 |
| InChIKey | UUOWQGQDPSMWOB-NFBCFJMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epicoccumspecies HS-1 (ncbitaxon:1030275) | - | PubMed (22418279) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4aS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one (CHEBI:206530) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aS,7R)-7-ethenyl-4b,10-dihydroxy-1,1,4a,7-tetramethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78437869 | ChemSpider |