EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-8,10,18-22,24-26,29H,9,11-17H2,1-6H3/b8-7+/t19-,20+,21-,22-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | QOXPZVASXWSKKU-UEIWAABPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma annulare (fungorum:282935) | - | PubMed (12781809) | |
| Ganoderma applanatum (ncbitaxon:29884) | - | DOI (10.1016/S0031-9422(00)91122-1) | |
| Ganoderma pfeifferi (ncbitaxon:34464) | fruit body (BTO:0000487) | PubMed (16378363) | |
| Tylopilus plumbeoviolaceus (ncbitaxon:182793) | fruit body (BTO:0000487) | PubMed (10785434) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) has parent hydride 5α-ergostane (CHEBI:20652) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) has role anti-HSV-1 agent (CHEBI:64953) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) has role antifungal agent (CHEBI:35718) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) has role metabolite (CHEBI:25212) |
| 5α-ergosta-7,22-dien-3β-ol (CHEBI:20651) is a 3β-sterol (CHEBI:35348) |
| IUPAC Name |
|---|
| 5α-ergosta-7,22-diene-3β-diol |
| Synonym | Source |
|---|---|
| 5-dihydroergosterol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST01030094 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3218631 | Reaxys |
| CAS:2465-11-4 | ChemIDplus |
| Citations |
|---|