EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O7 |
| Net Charge | 0 |
| Average Mass | 414.539 |
| Monoisotopic Mass | 414.26175 |
| SMILES | CCOC(=O)[C@H](C)[C@H]1CC[C@@H](C[C@H](C)OC(=O)[C@@H](C)[C@@H]2CC[C@H](C[C@@H](C)O)O2)O1 |
| InChI | InChI=1S/C22H38O7/c1-6-26-21(24)15(4)19-10-8-18(29-19)12-14(3)27-22(25)16(5)20-9-7-17(28-20)11-13(2)23/h13-20,23H,6-12H2,1-5H3/t13-,14+,15-,16+,17-,18+,19-,20+/m1/s1 |
| InChIKey | ZWKSCXUZDFPEQH-NPCDJYPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus pumilus (ncbitaxon:1408) | - | PubMed (25044594) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl nonactyl nonactate (CHEBI:206498) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(2S)-1-[(2S,5R)-5-[(2R)-1-ethoxy-1-oxopropan-2-yl]oxolan-2-yl]propan-2-yl] (2S)-2-[(2S,5R)-5-[(2R)-2-hydroxypropyl]oxolan-2-yl]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 78437868 | ChemSpider |