EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | C/C(=C\CCC(C)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](CC[C@H](O)[C@]4(C)C(=O)O)[C@]3(C)CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H46O5/c1-18(8-7-9-19(2)25(32)33)20-14-15-29(5)23-12-10-22-21(27(23,3)16-17-28(20,29)4)11-13-24(31)30(22,6)26(34)35/h9-10,18,20-21,23-24,31H,7-8,11-17H2,1-6H3,(H,32,33)(H,34,35)/b19-9+/t18?,20-,21-,23-,24+,27+,28-,29+,30-/m1/s1 |
| InChIKey | HRYAAXQQFUABSY-NWKDZZQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Russula vinosa (ncbitaxon:176830) | - | PubMed (30987109) |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24E)-3beta-hydroxycucurbita-5,24-diene-26,29-dioic acid (CHEBI:206470) is a cucurbitacin (CHEBI:16219) |
| IUPAC Name |
|---|
| (3S,4R,8R,9R,10S,13R,14S,17R)-17-[(E)-6-carboxyhept-5-en-2-yl]-3-hydroxy-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid |