EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O7 |
| Net Charge | 0 |
| Average Mass | 418.486 |
| Monoisotopic Mass | 418.19915 |
| SMILES | CCCCCCCCC/C=C/C(=O)CCc1c(O)c(C=O)c2c(c1O)C(=O)O[C@@H]2O |
| InChI | InChI=1S/C23H30O7/c1-2-3-4-5-6-7-8-9-10-11-15(25)12-13-16-20(26)17(14-24)18-19(21(16)27)23(29)30-22(18)28/h10-11,14,22,26-28H,2-9,12-13H2,1H3/b11-10+/t22-/m0/s1 |
| InChIKey | IPXWNHKZNHVKLL-NEQMZLFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria polymorpha (ncbitaxon:77046) | - | DOI (10.1002/jlac.1990199001154) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylaral (CHEBI:206441) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-1-oxo-6-[(E)-3-oxotetradec-4-enyl]-3H-2-benzouran-4-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 10281487 | ChemSpider |