EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O3 |
| Net Charge | 0 |
| Average Mass | 182.179 |
| Monoisotopic Mass | 182.06914 |
| SMILES | COc1ccc(C(N)=O)c(O)c1N |
| InChI | InChI=1S/C8H10N2O3/c1-13-5-3-2-4(8(10)12)7(11)6(5)9/h2-3,11H,9H2,1H3,(H2,10,12) |
| InChIKey | ADSMKVUNHDDYBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies DGC1 (ncbitaxon:1112742) | - | PubMed (23047245) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyramidamycin C (CHEBI:206404) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 3-amino-2-hydroxy-4-methoxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 29215411 | ChemSpider |