EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO4 |
| Net Charge | 0 |
| Average Mass | 245.234 |
| Monoisotopic Mass | 245.06881 |
| SMILES | O=C(O)c1ccc2n1Cc1c(ccc(O)c1O)C2 |
| InChI | InChI=1S/C13H11NO4/c15-11-4-1-7-5-8-2-3-10(13(17)18)14(8)6-9(7)12(11)16/h1-4,15-16H,5-6H2,(H,17,18) |
| InChIKey | MOFOFKUUAFKEGG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (31861067) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spathullin A (CHEBI:206385) is a carboxylic acid (CHEBI:33575) |
| Spathullin A (CHEBI:206385) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 6,7-dihydroxy-5,10-dihydropyrrolo[1,2-b]isoquinoline-3-carboxylic acid |