EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O8 |
| Net Charge | 0 |
| Average Mass | 336.296 |
| Monoisotopic Mass | 336.08452 |
| SMILES | COC(=O)c1cc(O)c(O)c2oc3c(c(=O)c12)[C@@H](OC)O[C@H](C)C3 |
| InChI | InChI=1S/C16H16O8/c1-6-4-9-11(16(22-3)23-6)13(19)10-7(15(20)21-2)5-8(17)12(18)14(10)24-9/h5-6,16-18H,4H2,1-3H3/t6-,16+/m1/s1 |
| InChIKey | DPBBEUPRGHXBOR-KXHHVGMCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | PubMed (28796420) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaetochromone C (CHEBI:206320) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| methyl (1S,3R)-6,7-dihydroxy-1-methoxy-3-methyl-10-oxo-3,4-dihydro-1H-pyrano[4,3-b]chromene-9-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 63002548 | ChemSpider |