EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37N3O6 |
| Net Charge | 0 |
| Average Mass | 463.575 |
| Monoisotopic Mass | 463.26824 |
| SMILES | CC[C@@H](C)[C@H](NC(C)=O)C(=O)N(C)[C@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C24H37N3O6/c1-7-15(4)21(25-16(5)28)23(31)27(6)20(13-17-8-10-18(29)11-9-17)22(30)26-19(24(32)33)12-14(2)3/h8-11,14-15,19-21,29H,7,12-13H2,1-6H3,(H,25,28)(H,26,30)(H,32,33)/t15-,19+,20-,21+/m1/s1 |
| InChIKey | YHTMLXXWOFCLDF-QAJUQPOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | DOI (10.1016/j.tet.2016.04.032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simplicilliumtide D (CHEBI:206283) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[[(2S,3R)-2-acetamido-3-methylpentanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 58196799 | ChemSpider |