EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44N8O12 |
| Net Charge | 0 |
| Average Mass | 780.792 |
| Monoisotopic Mass | 780.30787 |
| SMILES | CC(NC(=O)NC(Cc1cccc(O)c1)C(=O)O)C(=O)NC(C(=O)N/C=C1/CC(O)C(n2ccc(=O)nc2=O)O1)C(C)N(C)C(=O)C(N)Cc1cccc(O)c1 |
| InChI | InChI=1S/C36H44N8O12/c1-18(39-35(54)40-26(34(52)53)15-21-7-5-9-23(46)13-21)30(49)42-29(19(2)43(3)32(51)25(37)14-20-6-4-8-22(45)12-20)31(50)38-17-24-16-27(47)33(56-24)44-11-10-28(48)41-36(44)55/h4-13,17-19,25-27,29,33,45-47H,14-16,37H2,1-3H3,(H,38,50)(H,42,49)(H,52,53)(H2,39,40,54)(H,41,48,55)/b24-17- |
| InChIKey | IITFQSGNPIUSKU-ULJHMMPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coeruleorubidus (ncbitaxon:116188) | - | PubMed (11217807) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pacidamycin 5T (CHEBI:206276) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[1-[[3-[[2-amino-3-(3-hydroxyphenyl)propanoyl]-methylamino]-1-[[(Z)-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxyoxolan-2-ylidene]methyl]amino]-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]carbamoylamino]-3-(3-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8072758 | ChemSpider |