EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H59NO8 |
| Net Charge | 0 |
| Average Mass | 717.944 |
| Monoisotopic Mass | 717.42407 |
| SMILES | COC(/C(C)=C/C=C/C=C(C)/C=C/CC(O)CC(=O)/C=C/C=C(C)/C=C/C(C)NC(=O)C(C)C/C=C/CC(O)Cc1ccc(O)cc1)C(C)C(=O)O |
| InChI | InChI=1S/C43H59NO8/c1-30(14-8-9-17-32(3)41(52-7)35(6)43(50)51)15-12-20-39(47)29-40(48)21-13-16-31(2)22-23-34(5)44-42(49)33(4)18-10-11-19-38(46)28-36-24-26-37(45)27-25-36/h8-17,21-27,33-35,38-39,41,45-47H,18-20,28-29H2,1-7H3,(H,44,49)(H,50,51)/b9-8+,11-10+,15-12+,21-13+,23-22+,30-14+,31-16+,32-17+ |
| InChIKey | OLQJTQUNKZJRHG-SIMXWEICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis (ncbitaxon:57975) | - | PubMed (22517609) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thailandamide (CHEBI:206273) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (4E,6E,8E,10E,16E,18E,20E)-13-hydroxy-22-[[(E)-7-hydroxy-8-(4-hydroxyphenyl)-2-methyloct-4-enoyl]amino]-3-methoxy-2,4,9,19-tetramethyl-15-oxotricosa-4,6,8,10,16,18,20-heptaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78444121 | ChemSpider |