EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39N7O12 |
| Net Charge | 0 |
| Average Mass | 653.646 |
| Monoisotopic Mass | 653.26567 |
| SMILES | O=CN(O)CCC[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)c1ccccc1O)C(=O)NCCC(=O)N[C@@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C27H39N7O12/c35-13-19(31-23(40)16-5-1-2-8-21(16)38)26(43)32-20(14-36)25(42)30-17(6-3-11-33(45)15-37)24(41)28-10-9-22(39)29-18-7-4-12-34(46)27(18)44/h1-2,5,8,15,17-20,35-36,38,45-46H,3-4,6-7,9-14H2,(H,28,41)(H,29,39)(H,30,42)(H,31,40)(H,32,43)/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FDGWTXKXYPUPIF-ZRNYENFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies RM-14-6 (ncbitaxon:1353416) | - | PubMed (28029795) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxachelin B (CHEBI:206258) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[(2S)-1-[[(2S)-1-[[(2R)-5-[ormyl(hydroxy)amino]-1-[[3-[[(3R)-1-hydroxy-2-oxopiperidin-3-yl]amino]-3-oxopropyl]amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]-2-hydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 76794053 | ChemSpider |