EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O2S2 |
| Net Charge | 0 |
| Average Mass | 244.341 |
| Monoisotopic Mass | 244.03402 |
| SMILES | CS/C=C1\NC(=O)C(NC(C)=O)=C1SC |
| InChI | InChI=1S/C9H12N2O2S2/c1-5(12)10-7-8(15-3)6(4-14-2)11-9(7)13/h4H,1-3H3,(H,10,12)(H,11,13)/b6-4- |
| InChIKey | NLSSAAYJAFOHJO-XQRVVYSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (28627048) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1Z)-S,S'-dimethyldihydroholomycin (CHEBI:206257) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(5Z)-4-methylsulanyl-5-(methylsulanylmethylidene)-2-oxopyrrol-3-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 62285711 | ChemSpider |