EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8Cl2O4 |
| Net Charge | 0 |
| Average Mass | 251.065 |
| Monoisotopic Mass | 249.97996 |
| SMILES | O=C(O)CCc1cc(O)c(Cl)c(O)c1Cl |
| InChI | InChI=1S/C9H8Cl2O4/c10-7-4(1-2-6(13)14)3-5(12)8(11)9(7)15/h3,12,15H,1-2H2,(H,13,14) |
| InChIKey | OIVFENSIFOAGLA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascotricha sinuosa (ncbitaxon:1217297) | - | PubMed (28374459) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hansfordiol I (CHEBI:206242) is a benzenes (CHEBI:22712) |
| Hansfordiol I (CHEBI:206242) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(2,4-dichloro-3,5-dihydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61708735 | ChemSpider |