EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9ClO4 |
| Net Charge | 0 |
| Average Mass | 216.620 |
| Monoisotopic Mass | 216.01894 |
| SMILES | O=C(O)CCc1cc(O)cc(O)c1Cl |
| InChI | InChI=1S/C9H9ClO4/c10-9-5(1-2-8(13)14)3-6(11)4-7(9)12/h3-4,11-12H,1-2H2,(H,13,14) |
| InChIKey | FIFAINOEVYKTFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascotricha sinuosa (ncbitaxon:1217297) | - | PubMed (28374459) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hansfordiol H (CHEBI:206236) is a benzenes (CHEBI:22712) |
| Hansfordiol H (CHEBI:206236) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(2-chloro-3,5-dihydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61708734 | ChemSpider |