EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O2 |
| Net Charge | 0 |
| Average Mass | 328.496 |
| Monoisotopic Mass | 328.24023 |
| SMILES | Cc1ccc2c(c1O)[C@@]1(C)CC[C@H]3[C@@](C)(CO)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C22H32O2/c1-14-6-7-15-12-17-21(3)10-5-9-20(2,13-23)16(21)8-11-22(17,4)18(15)19(14)24/h6-7,16-17,23-24H,5,8-13H2,1-4H3/t16-,17+,20+,21-,22-/m0/s1 |
| InChIKey | QLLVZMNPEACNBC-HFQQBTNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dasyscyphus (ncbitaxon:318839) | - | PubMed (18771321) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dasyscyphin E (CHEBI:206162) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (4S,4aR,6aS,11aR,11bR)-4-(hydroxymethyl)-4,6a,8,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]luoren-7-ol |
| Manual Xrefs | Databases |
|---|---|
| 29304992 | ChemSpider |