EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H59N5O7 |
| Net Charge | 0 |
| Average Mass | 721.940 |
| Monoisotopic Mass | 721.44145 |
| SMILES | COc1ccc(CC(C(N)=O)N(C)C(=O)C(C)N(C)C(=O)C(C)NC(=O)C(Cc2ccccc2)N(C)C(=O)C(C)CC(C)CCCCC(C)=O)cc1 |
| InChI | InChI=1S/C40H59N5O7/c1-26(15-13-14-16-28(3)46)23-27(2)38(49)45(8)35(25-31-17-11-10-12-18-31)37(48)42-29(4)39(50)43(6)30(5)40(51)44(7)34(36(41)47)24-32-19-21-33(52-9)22-20-32/h10-12,17-22,26-27,29-30,34-35H,13-16,23-25H2,1-9H3,(H2,41,47)(H,42,48) |
| InChIKey | FZTCTTODSSJQQB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (9584405) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carmabin B (CHEBI:206137) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| N-[1-[[1-[[1-[[1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-methylamino]-1-oxopropan-2-yl]-methylamino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-N,2,4-trimethyl-9-oxodecanamide |
| Manual Xrefs | Databases |
|---|---|
| 8946480 | ChemSpider |