EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N2O9S2 |
| Net Charge | 0 |
| Average Mass | 640.821 |
| Monoisotopic Mass | 640.24882 |
| SMILES | C/C(=C\C(=O)OCCCCCCCC(=O)NC1C(=O)NC2=CSSC21)[C@@H](O)[C@@H]1OC[C@@H](C/C=C/[C@@H](C)[C@H](C)O)[C@H](O)C1=O |
| InChI | InChI=1S/C30H44N2O9S2/c1-17(19(3)33)10-9-11-20-15-41-28(27(38)26(20)37)25(36)18(2)14-23(35)40-13-8-6-4-5-7-12-22(34)32-24-29-21(16-42-43-29)31-30(24)39/h9-10,14,16-17,19-20,24-26,28-29,33,36-37H,4-8,11-13,15H2,1-3H3,(H,31,39)(H,32,34)/b10-9+,18-14+/t17-,19+,20-,24?,25-,26+,28+,29?/m1/s1 |
| InChIKey | BYYBFQHMUAXQSR-WWGFETBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonasspecies (ncbitaxon:53249) | - | PubMed (28181382) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-7-epi-6-ketothiomarinol A (CHEBI:206127) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [8-oxo-8-[(5-oxo-6,6a-dihydro-4H-dithiolo[4,3-b]pyrrol-6-yl)amino]octyl] (E,4R)-4-hydroxy-4-[(2S,4S,5R)-4-hydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-3-oxooxan-2-yl]-3-methylbut-2-enoate |