EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | NCCO/C=C/[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1 |
| InChIKey | USGUVNUTPWXWBA-JRIXXDKMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (4850608) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-Amino-4-(2-aminoethoxy)-trans-3-butenoic acid (CHEBI:206077) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (E)-2-amino-4-(2-aminoethoxy)but-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4572397 | ChemSpider |