EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O10 |
| Net Charge | 0 |
| Average Mass | 514.612 |
| Monoisotopic Mass | 514.27780 |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@](O)(C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O)[C@@H](O)C1=O |
| InChI | InChI=1S/C26H42O10/c1-16(13-22(30)34-11-9-7-5-4-6-8-10-21(28)29)12-19-23(31)25(32)26(33,15-35-19)14-20-24(36-20)17(2)18(3)27/h13,17-20,24-25,27,32-33H,4-12,14-15H2,1-3H3,(H,28,29)/b16-13+/t17-,18-,19-,20-,24-,25-,26+/m0/s1 |
| InChIKey | NETKPOCGEWTYQU-MYOHEURVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonasspecies (ncbitaxon:53249) | - | PubMed (28181382) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mupirocin P (CHEBI:206063) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 9-[(E)-4-[(2S,4R,5R)-4,5-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]-3-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 61360242 | ChemSpider |