EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35NO |
| Net Charge | 0 |
| Average Mass | 401.594 |
| Monoisotopic Mass | 401.27186 |
| SMILES | CC(C)=CCC[C@]12c3cc4c(cc3CC[C@@]1(C)[C@H](C)CC[C@@H]2O)nc1ccccc14 |
| InChI | InChI=1S/C28H35NO/c1-18(2)8-7-14-28-23-17-22-21-9-5-6-10-24(21)29-25(22)16-20(23)13-15-27(28,4)19(3)11-12-26(28)30/h5-6,8-10,16-17,19,26,29-30H,7,11-15H2,1-4H3/t19-,26+,27+,28-/m1/s1 |
| InChIKey | BWCQRIGHZTXFEA-AIERRPMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus tubingensis (ncbitaxon:5068) | - | DOI (10.1021/jo00281a010) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tubingensin A (CHEBI:206060) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (16S,17R,20S,21R)-16,17-dimethyl-21-(4-methylpent-3-enyl)-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12-hexaen-20-ol |
| Manual Xrefs | Databases |
|---|---|
| 10267469 | ChemSpider |