EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O4 |
| Net Charge | 0 |
| Average Mass | 480.689 |
| Monoisotopic Mass | 480.32396 |
| SMILES | C=C(CC[C@@H](C(=O)O)[C@H]1[C@H](O)C[C@@]2(C)C3=CC=C4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H44O4/c1-18(2)19(3)9-10-20(27(34)35)26-23(32)17-31(8)22-11-12-24-28(4,5)25(33)14-15-29(24,6)21(22)13-16-30(26,31)7/h11-13,18,20,23,26,32H,3,9-10,14-17H2,1-2,4-8H3,(H,34,35)/t20-,23-,26+,29-,30-,31+/m1/s1 |
| InChIKey | KYMRBBLOALEVRA-OXRYRGBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wolfiporia cocos (ncbitaxon:81056) | - | PubMed (27808511) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16alpha-hydroxy-3-oxo-24-methyllanosta-5,7,9(11),24(31)-tetraen-21-oic acid (CHEBI:206041) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2R)-2-[(10R,13R,14R,16R,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,12,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 76789867 | ChemSpider |